|
CAS#: 17341-02-5 Product: 6,7,14,15-Tetrahydro-syn-(5,16:8,13)-Diethenodibenzo[a,g]cyclododecene No suppilers available for the product. |
| Name | 6,7,14,15-Tetrahydro-syn-(5,16:8,13)-Diethenodibenzo[a,g]cyclododecene |
|---|---|
| Synonyms | Anti-(5,16:8,13)-Dthenodibenzo(A,G)Cyclododecene, 6,7,14,15-Tetrahydro-; 5,16:8,13-Diethenodibenzo[A,G]Cyclododecane, 6,7,14,15-Tetrahydro; Anti-(5,16:8,13)-Diethenodibenzo[A,G] Cyclododecene 6,7,14,15-Tetrahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C24H20 |
| Molecular Weight | 308.42 |
| CAS Registry Number | 17341-02-5 |
| SMILES | C1=CC=CC2=C4C=CC(=C12)CCC3=C5C(=C(C=C3)CC4)C=CC=C5 |
| InChI | 1S/C24H20/c1-2-6-22-18-10-9-17(21(22)5-1)13-14-19-11-12-20(16-15-18)24-8-4-3-7-23(19)24/h1-12H,13-16H2 |
| InChIKey | FETNXYIKSUXFQS-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.078°C at 760 mmHg (Cal.) |
| Flash point | 251.578°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7,14,15-Tetrahydro-syn-(5,16:8,13)-Diethenodibenzo[a,g]cyclododecene |