Online Database of Chemicals from Around the World
| Name | Bis[4-(Trifluoromethoxy)Phenyl] Sulphone |
|---|---|
| Synonyms | 1-(Trifluoromethoxy)-4-[4-(Trifluoromethoxy)Phenyl]Sulfonyl-Benzene; Bis(4-(Trifluoromethoxy)Phenyl) Sulphone |
| Molecular Structure | ![CAS#: 1735-37-1, Bis[4-(Trifluoromethoxy)Phenyl] Sulphone](/moreStructures/1735-37-1.gif) |
| Molecular Formula | C14H8F6O4S |
| Molecular Weight | 386.27 |
| CAS Registry Number | 1735-37-1 |
| EINECS | 217-078-9 |
| SMILES | C2=C([S](C1=CC=C(OC(F)(F)F)C=C1)(=O)=O)C=CC(=C2)OC(F)(F)F |
| InChI | 1S/C14H8F6O4S/c15-13(16,17)23-9-1-5-11(6-2-9)25(21,22)12-7-3-10(4-8-12)24-14(18,19)20/h1-8H |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.448°C at 760 mmHg (Cal.) |
| Flash point | 180.865°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[4-(Trifluoromethoxy)Phenyl] Sulphone |
