|
CAS#: 17364-04-4 Product: N-[1-(4-Aminophenyl)-1,3-Dihydroxy-2-Propanyl]-2,2-Dichloroacetamide No suppilers available for the product. |
| Name | N-[1-(4-Aminophenyl)-1,3-Dihydroxy-2-Propanyl]-2,2-Dichloroacetamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H14Cl2N2O3 |
| Molecular Weight | 293.15 |
| CAS Registry Number | 17364-04-4 |
| SMILES | ClC(Cl)C(=O)NC(C(O)c1ccc(N)cc1)CO |
| InChI | 1S/C11H14Cl2N2O3/c12-10(13)11(18)15-8(5-16)9(17)6-1-3-7(14)4-2-6/h1-4,8-10,16-17H,5,14H2,(H,15,18) |
| InChIKey | BFLNGKUCFYKCFZ-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 634.658°C at 760 mmHg (Cal.) |
| Flash point | 337.629°C (Cal.) |
| Refractive index | 1.623 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[1-(4-Aminophenyl)-1,3-Dihydroxy-2-Propanyl]-2,2-Dichloroacetamide |