|
CAS#: 17369-61-8 Product: 5-Ethyl-3,4,5,6-Tetramethylcyclohexen-2-One No suppilers available for the product. |
| Name | 5-Ethyl-3,4,5,6-Tetramethylcyclohexen-2-One |
|---|---|
| Synonyms | 5-Ethyl-3,4,5,6-Tetramethyl-Cyclohex-2-En-1-One; 5-Ethyl-3,4,5,6-Tetramethyl-1-Cyclohex-2-Enone; 5-Ethyl-3,4,5,6-Tetramethyl-2-Cyclohexen-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 17369-61-8 |
| EINECS | 241-404-9 |
| SMILES | C(C1(C(C(=O)C=C(C1C)C)C)C)C |
| InChI | 1S/C12H20O/c1-6-12(5)9(3)8(2)7-11(13)10(12)4/h7,9-10H,6H2,1-5H3 |
| InChIKey | NWRKGLAPSUFTME-UHFFFAOYSA-N |
| Density | 0.858g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.584°C at 760 mmHg (Cal.) |
| Flash point | 100.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-3,4,5,6-Tetramethylcyclohexen-2-One |