|
CAS#: 17378-82-4 Product: 1,10-Phenanthroline cuprous complex No suppilers available for the product. |
| Name | 1,10-Phenanthroline cuprous complex |
|---|---|
| Synonyms | Cuprous 1,10-Phenanthroline; 1,10-Phenanthroline Cuprous Complex; Bis(1,10-Phenanthroline)-Copper(I)Ion |
| Molecular Structure | ![]() |
| Molecular Formula | C24H16CuN4 |
| Molecular Weight | 423.96 |
| CAS Registry Number | 17378-82-4 |
| SMILES | [Cu+].C1=CC=NC2=C3C(=CC=C12)C=CC=N3.C4=CC=NC5=C6C(=CC=C45)C=CC=N6 |
| InChI | 1S/2C12H8N2.Cu/c2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h2*1-8H;/q;;+1 |
| InChIKey | ZEADRBDFSWYVGV-UHFFFAOYSA-N |
| Boiling point | 365.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 164.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,10-Phenanthroline cuprous complex |