|
CAS#: 17380-78-8 Product: Methyl 1-Phenylcyclohexanecarboxylate No suppilers available for the product. |
| Name | Methyl 1-Phenylcyclohexanecarboxylate |
|---|---|
| Synonyms | methyl 1-phenylcyclohexanecarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 17380-78-8 |
| SMILES | O=C(OC)C1(CCCCC1)c2ccccc2 |
| InChI | 1S/C14H18O2/c1-16-13(15)14(10-6-3-7-11-14)12-8-4-2-5-9-12/h2,4-5,8-9H,3,6-7,10-11H2,1H3 |
| InChIKey | SGCPKFJYODXFOZ-UHFFFAOYSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.781°C at 760 mmHg (Cal.) |
| Flash point | 129.536°C (Cal.) |
| Refractive index | 1.521 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1-Phenylcyclohexanecarboxylate |