|
CAS#: 17397-37-4 Product: 2-Bromo-2,2-Diphenylacetyl Chloride No suppilers available for the product. |
| Name | 2-Bromo-2,2-Diphenylacetyl Chloride |
|---|---|
| Synonyms | 2-Bromo-2,2-Di(Phenyl)Ethanoyl Bromide; 2-Bromo-2,2-Diphenylacetyl Bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Br2O |
| Molecular Weight | 354.04 |
| CAS Registry Number | 17397-37-4 |
| EINECS | 241-423-2 |
| SMILES | C2=C(C(C(=O)Br)(C1=CC=CC=C1)Br)C=CC=C2 |
| InChI | 1S/C14H10Br2O/c15-13(17)14(16,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | ZFQFBVWNRNLAFC-UHFFFAOYSA-N |
| Density | 1.688g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.625°C at 760 mmHg (Cal.) |
| Flash point | 88.083°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-2,2-Diphenylacetyl Chloride |