|
CAS#: 174079-87-9 Product: 1-Methoxy-4-[4-[(E)-2-(4-Vinylcyclohexyl)Vinyl]Cyclohexyl]Benzene No suppilers available for the product. |
| Name | 1-Methoxy-4-[4-[(E)-2-(4-Vinylcyclohexyl)Vinyl]Cyclohexyl]Benzene |
|---|---|
| Synonyms | Benzene, |
| Molecular Structure | ![]() |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.50 |
| CAS Registry Number | 174079-87-9 |
| SMILES | COc1ccc(cc1)[C@H]2CC[C@@H](CC2)/C=C/[C@H]3CC[C@@H](CC3)C=C |
| InChI | 1S/C23H32O/c1-3-18-4-6-19(7-5-18)8-9-20-10-12-21(13-11-20)22-14-16-23(24-2)17-15-22/h3,8-9,14-21H,1,4-7,10-13H2,2H3/b9-8+/t18-,19-,20-,21- |
| InChIKey | UJKPXBPSUYJSRC-CPJRXUKVSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.751°C at 760 mmHg (Cal.) |
| Flash point | 176.185°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-4-[4-[(E)-2-(4-Vinylcyclohexyl)Vinyl]Cyclohexyl]Benzene |