|
CAS#: 17423-48-2 Product: 4-Aminophenanthrenes No suppilers available for the product. |
| Name | 4-Aminophenanthrenes |
|---|---|
| Synonyms | 4-Phenanthrenamine; 4-Phenanthrylamine; Ccris 7005 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 |
| CAS Registry Number | 17423-48-2 |
| SMILES | C2=CC1=CC=CC=C1C3=C(C=CC=C23)N |
| InChI | 1S/C14H11N/c15-13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h1-9H,15H2 |
| InChIKey | AFPNTTFBCMSLLO-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.206°C at 760 mmHg (Cal.) |
| Flash point | 224.415°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Aminophenanthrenes |