|
CAS#: 17429-55-9 Product: (6E)-6-(2-Furylmethylene)-2,2,3-Trimethylcyclohexanone No suppilers available for the product. |
| Name | (6E)-6-(2-Furylmethylene)-2,2,3-Trimethylcyclohexanone |
|---|---|
| Synonyms | (6E)-6-(2-Furylmethylene)-2,2,3-trimethylcyclohexanone #; 2-Furfurylidene-5,6,6-trimethylcyclohexanone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 17429-55-9 |
| SMILES | O=C2\C(=C\c1occc1)CCC(C2(C)C)C |
| InChI | 1S/C14H18O2/c1-10-6-7-11(13(15)14(10,2)3)9-12-5-4-8-16-12/h4-5,8-10H,6-7H2,1-3H3/b11-9+ |
| InChIKey | GNXZHCBRQQQSFL-PKNBQFBNSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.22°C at 760 mmHg (Cal.) |
| Flash point | 145.797°C (Cal.) |
| Refractive index | 1.523 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (6E)-6-(2-Furylmethylene)-2,2,3-Trimethylcyclohexanone |