|
CAS#: 174350-05-1 Product: 1-Ethoxy-2,3-Difluoro-4-(4-Propylcyclohexyl)Benzene No suppilers available for the product. |
| Name | 1-Ethoxy-2,3-Difluoro-4-(4-Propylcyclohexyl)Benzene |
|---|---|
| Synonyms | trans-1-Ethoxy-2,3-difluoro-4-(4-propyl-cyclohexyl)-benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 |
| CAS Registry Number | 174350-05-1 |
| SMILES | CCC[C@H]1CC[C@@H](CC1)c2c(c(c(cc2)OCC)F)F |
| InChI | 1S/C17H24F2O/c1-3-5-12-6-8-13(9-7-12)14-10-11-15(20-4-2)17(19)16(14)18/h10-13H,3-9H2,1-2H3/t12-,13- |
| InChIKey | BOAHGIPRRKDVQY-JOCQHMNTSA-N |
| Density | 1.032g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.642°C at 760 mmHg (Cal.) |
| Flash point | 158.682°C (Cal.) |
| Refractive index | 1.477 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethoxy-2,3-Difluoro-4-(4-Propylcyclohexyl)Benzene |