|
CAS#: 17443-96-8 Product: 1,5,10,10-Tetramethyl-2,4,6,8,9-Pentathiatricyclo[3.3.1.13,7]Decane No suppilers available for the product. |
| Name | 1,5,10,10-Tetramethyl-2,4,6,8,9-Pentathiatricyclo[3.3.1.13,7]Decane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H14S5 |
| Molecular Weight | 282.53 |
| CAS Registry Number | 17443-96-8 |
| SMILES | S1C3SC2(SC(SC1(S2)C)C3(C)C)C |
| InChI | 1S/C9H14S5/c1-7(2)5-10-8(3)11-6(7)13-9(4,12-5)14-8/h5-6H,1-4H3 |
| InChIKey | DVNVCYCMGCJQBB-UHFFFAOYSA-N |
| Density | 1.38g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.881°C at 760 mmHg (Cal.) |
| Flash point | 162.236°C (Cal.) |
| Refractive index | 1.693 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5,10,10-Tetramethyl-2,4,6,8,9-Pentathiatricyclo[3.3.1.13,7]Decane |