Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 4,5,6,7-Tetraiodo-3H-2,1-Benzoxathiol-3-One 1,1-Dioxide |
|---|---|
| Synonyms | 4,5,6,7-Tetraiodo-3H-2,1-benzoxathiol-3-one 1,1-dioxide #; Tetraiodo-2-sulfobenzoic Anhydride |
| Molecular Structure |  |
| Molecular Formula | C7I4O4S |
| Molecular Weight | 687.76 |
| CAS Registry Number | 1745-83-1 |
| SMILES | Ic1c2c(c(I)c(I)c1I)C(=O)OS2(=O)=O |
| InChI | 1S/C7I4O4S/c8-2-1-6(5(11)4(10)3(2)9)16(13,14)15-7(1)12 |
| InChIKey | UQDQTEHMZFWZSX-UHFFFAOYSA-N |
| Density | 3.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.628°C at 760 mmHg (Cal.) |
| Flash point | 303.744°C (Cal.) |
| Refractive index | 1.876 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,5,6,7-Tetraiodo-3H-2,1-Benzoxathiol-3-One 1,1-Dioxide |