| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | (1S,12R)-2,5,8,11-tetraoxabicyclo[10.4.0]hexadecane |
|---|---|
| Synonyms | Zinc04262180; Zinc04262181 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 |
| CAS Registry Number | 17454-42-1 |
| SMILES | [C@@H]12OCCOCCOCCO[C@@H]1CCCC2 |
| InChI | 1S/C12H22O4/c1-2-4-12-11(3-1)15-9-7-13-5-6-14-8-10-16-12/h11-12H,1-10H2/t11-,12+ |
| InChIKey | ILCAEFFUYHJPAL-TXEJJXNPSA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.804°C at 760 mmHg (Cal.) |
| Flash point | 129.014°C (Cal.) |
| (1) | S. A. Kotlyar, R. I. Zubatyuk, O. V. Shishkin, G. N. Chuprin, A. V. Kiriyak and G. L. Kamalov. Bis(cis-cyclohexano-12-crown-4)potassium chlorochromate, Acta Cryst. (2004). E60, m907-m909 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1S,12R)-2,5,8,11-tetraoxabicyclo[10.4.0]hexadecane |