|
CAS#: 174805-87-9 Product: 5-[4-(4-Ethylcyclohexyl)-2-Fluoro-Phenyl]-1,2,3-Trifluoro-Benzene No suppilers available for the product. |
| Name | 5-[4-(4-Ethylcyclohexyl)-2-Fluoro-Phenyl]-1,2,3-Trifluoro-Benzene |
|---|---|
| Synonyms | 1,1'-Biph |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20F4 |
| Molecular Weight | 336.37 |
| CAS Registry Number | 174805-87-9 |
| SMILES | CC[C@H]1CC[C@@H](CC1)c2cc(c(cc2)c3cc(c(c(c3)F)F)F)F |
| InChI | 1S/C20H20F4/c1-2-12-3-5-13(6-4-12)14-7-8-16(17(21)9-14)15-10-18(22)20(24)19(23)11-15/h7-13H,2-6H2,1H3/t12-,13- |
| InChIKey | AXHIYBDTRMNUFJ-JOCQHMNTSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.426°C at 760 mmHg (Cal.) |
| Flash point | 166.905°C (Cal.) |
| Refractive index | 1.504 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[4-(4-Ethylcyclohexyl)-2-Fluoro-Phenyl]-1,2,3-Trifluoro-Benzene |