|
CAS#: 17512-08-2 Product: 5-(2-Methyl-2,3-Butadienyl)-1,3,4-Trimethyl-Pyrazole No suppilers available for the product. |
| Name | 5-(2-Methyl-2,3-Butadienyl)-1,3,4-Trimethyl-Pyrazole |
|---|---|
| Synonyms | Pyrazole, 5-(2-Methyl-2,3-Butadienyl)-1,3,4-Trimethyl-; Pyrazole, 1,3,4-Trimethyl-5-(2-Methyl-2,3-Butadienyl)-; Pyrazole, 5-(2-Methyl-2,3-Butadienyl)-1,3,4-Trimethyl-, |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 |
| CAS Registry Number | 17512-08-2 |
| SMILES | C(C1=C(C(=N[N]1C)C)C)[C](=[C]=[CH2])C |
| InChI | 1S/C11H16N2/c1-6-8(2)7-11-9(3)10(4)12-13(11)5/h1,7H2,2-5H3 |
| InChIKey | FXOTWDYPDWRMSA-UHFFFAOYSA-N |
| Density | 0.917g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.379°C at 760 mmHg (Cal.) |
| Flash point | 124.578°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2-Methyl-2,3-Butadienyl)-1,3,4-Trimethyl-Pyrazole |