|
CAS#: 175203-35-7 Product: 2-(2,3-Dihydro-1,4-Benzodioxin-2-Yl)-1,3-Thiazole-4-Carbonyl Chloride No suppilers available for the product. |
| Name | 2-(2,3-Dihydro-1,4-Benzodioxin-2-Yl)-1,3-Thiazole-4-Carbonyl Chloride |
|---|---|
| Synonyms | 2-(1,4-Benzodioxan-2-yl)thiazole-4-carbonylchloride; 4-THIAZOL |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClNO3S |
| Molecular Weight | 281.71 |
| CAS Registry Number | 175203-35-7 |
| SMILES | ClC(=O)c1csc(n1)C2Oc3ccccc3OC2 |
| InChI | 1S/C12H8ClNO3S/c13-11(15)7-6-18-12(14-7)10-5-16-8-3-1-2-4-9(8)17-10/h1-4,6,10H,5H2 |
| InChIKey | ZPEAGTZLDSQPFE-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.257°C at 760 mmHg (Cal.) |
| Flash point | 207.964°C (Cal.) |
| Refractive index | 1.63 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,3-Dihydro-1,4-Benzodioxin-2-Yl)-1,3-Thiazole-4-Carbonyl Chloride |