| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 3,4-Bis(Benzylamino)-3-Cyclobutene-1,2-Dione |
|---|---|
| Synonyms | 3-CYCLOBUTENE-1,2-DIONE,3,4-BIS[(PHENYLMETHYL)AMINO]-; Cyclobutene-1,2-diol, 3,4-bis(benzylimino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.33 |
| CAS Registry Number | 175204-25-8 |
| SMILES | C1=CC=C(C=C1)CNC2=C(C(=O)C2=O)NCC3=CC=CC=C3 |
| InChI | 1S/C18H16N2O2/c21-17-15(19-11-13-7-3-1-4-8-13)16(18(17)22)20-12-14-9-5-2-6-10-14/h1-10,19-20H,11-12H2 |
| InChIKey | CDQDQDSGKAKONQ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.8±55.0°C at 760 mmHg (Cal.) |
| Flash point | 175.4±31.7°C (Cal.) |
| Refractive index | 1.646 (Cal.) |
| (1) | Valeria Amendola, Luigi Fabbrizzi and Lorenzo Mosca. Anion recognition by hydrogen bonding: urea-based receptors, Chem. Soc. Rev., 2010, 39, 3889. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,4-Bis(Benzylamino)-3-Cyclobutene-1,2-Dione |