| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | N-Allyl-4,5-Dimethyl-2-(Trimethylsilyl)-3-Thiophenecarboxamide |
| Synonyms | SILTHIOFAM |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21NOSSi |
| Molecular Weight | 267.46 |
| CAS Registry Number | 175217-20-6 |
| SMILES | O=C(c1c(c(sc1[Si](C)(C)C)C)C)NC\C=C |
| InChI | 1S/C13H21NOSSi/c1-7-8-14-12(15)11-9(2)10(3)16-13(11)17(4,5)6/h7H,1,8H2,2-6H3,(H,14,15) |
| InChIKey | MXMXHPPIGKYTAR-UHFFFAOYSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.235°C at 760 mmHg (Cal.) |
| Flash point | 137.192°C (Cal.) |
| Refractive index | 1.513 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Allyl-4,5-Dimethyl-2-(Trimethylsilyl)-3-Thiophenecarboxamide |