|
CAS#: 17536-04-8 Product: N-(1-Methylpyrrolidin-2-Ylidene)-4-Nitro-1-Benzenamine No suppilers available for the product. |
| Name | N-(1-Methylpyrrolidin-2-Ylidene)-4-Nitro-1-Benzenamine |
|---|---|
| Synonyms | 1-Methyl-N-(4-Nitrophenyl)-2-Pyrrolidinimine; (1-Methylpyrrolidin-2-Ylidene)-(4-Nitrophenyl)Amine; 5-21-06-00326 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 |
| CAS Registry Number | 17536-04-8 |
| SMILES | C1=CC(=CC=C1[N+]([O-])=O)N=C2N(CCC2)C |
| InChI | 1S/C11H13N3O2/c1-13-8-2-3-11(13)12-9-4-6-10(7-5-9)14(15)16/h4-7H,2-3,8H2,1H3 |
| InChIKey | DRMVHXFUXPZWOI-UHFFFAOYSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.749°C at 760 mmHg (Cal.) |
| Flash point | 175.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(1-Methylpyrrolidin-2-Ylidene)-4-Nitro-1-Benzenamine |