|
CAS#: 17557-09-4 Product: Trimethyl-[4-(trimethylsilylmethyl)benzyl]silane No suppilers available for the product. |
| Name | Trimethyl-[4-(trimethylsilylmethyl)benzyl]silane |
|---|---|
| Synonyms | Trimethyl-[4-(Trimethylsilylmethyl)Benzyl]Silane; Silane,[1,4-Phenylenebis(Methylene)]Bis[Trimethyl; Silane, (1,4-Phenylenebis(Methylene))Bis(Trimethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H26Si2 |
| Molecular Weight | 250.53 |
| CAS Registry Number | 17557-09-4 |
| SMILES | C1=CC(=CC=C1C[Si](C)(C)C)C[Si](C)(C)C |
| InChI | 1S/C14H26Si2/c1-15(2,3)11-13-7-9-14(10-8-13)12-16(4,5)6/h7-10H,11-12H2,1-6H3 |
| InChIKey | IYXXYCYJDDVART-UHFFFAOYSA-N |
| Density | 0.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.51°C at 760 mmHg (Cal.) |
| Flash point | 103.943°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl-[4-(trimethylsilylmethyl)benzyl]silane |