| Georganics Ltd. | Slovakia | Inquire | ||
|---|---|---|---|---|
![]() |
+421 (33) 640-3132 | |||
![]() |
georganics@nextra.sk | |||
| Chemical manufacturer since 1998 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Name | 1-[4-(Diphenylamino)Phenyl]Ethanone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 |
| CAS Registry Number | 1756-32-7 |
| SMILES | CC(=O)c1ccc(cc1)N(c2ccccc2)c3ccccc3 |
| InChI | 1S/C20H17NO/c1-16(22)17-12-14-20(15-13-17)21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15H,1H3 |
| InChIKey | PDBZHEMVWXFWIT-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.853°C at 760 mmHg (Cal.) |
| Flash point | 173.741°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| SDS | Available |
|---|---|
| (1) | H.-L. Wang, B. Zhang, W.-Y. Xu, Y.-Q. Bai and H. Wu. (4-Acetylphenyl)diphenylamine, Acta Cryst. (2007). E63, o2648-o2649 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-[4-(Diphenylamino)Phenyl]Ethanone |