|
CAS#: 17576-41-9 Product: Ethyl-Carbamicacid 4-Nitrophenylester No suppilers available for the product. |
| Name | Ethyl-Carbamicacid 4-Nitrophenylester |
|---|---|
| Synonyms | N-Ethylcarbamic Acid (4-Nitrophenyl) Ester; 4-Nitrophenyl Ethylcarbamate; Ai3-27285 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 |
| CAS Registry Number | 17576-41-9 |
| SMILES | C1=CC(=CC=C1OC(NCC)=O)[N+]([O-])=O |
| InChI | 1S/C9H10N2O4/c1-2-10-9(12)15-8-5-3-7(4-6-8)11(13)14/h3-6H,2H2,1H3,(H,10,12) |
| InChIKey | QVUXGCDXMKCVSB-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.137°C at 760 mmHg (Cal.) |
| Flash point | 152.857°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl-Carbamicacid 4-Nitrophenylester |