| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054//+86 13424336463 | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1H-Imidazole-2,4-Dicarboxylic Acid |
|---|---|
| Synonyms | 1H-Imidazole-2,4-dicarboxylicacid; 1H-IMIDAZOLE-2,5-DICARBOXYLICACID |
| Molecular Structure | ![]() |
| Molecular Formula | C5H4N2O4 |
| Molecular Weight | 156.10 |
| CAS Registry Number | 175874-61-0 |
| SMILES | C1=C(N=C(N1)C(=O)O)C(=O)O |
| InChI | 1S/C5H4N2O4/c8-4(9)2-1-6-3(7-2)5(10)11/h1H,(H,6,7)(H,8,9)(H,10,11) |
| InChIKey | ZUUNZDIGHGJBAR-UHFFFAOYSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 614.8±47.0°C at 760 mmHg (Cal.) |
| Flash point | 325.6±29.3°C (Cal.) |
| Refractive index | 1.683 (Cal.) |
| (1) | Yunling Liu, Victor Kravtsov, Rosa D. Walsh, Pankaj Poddar, Hariharan Srikanth and Mohamed Eddaoudi. Directed assembly of metal–organic cubes from deliberately predesigned molecular building blocks, Chem. Commun., 2004, 0, 2806. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1H-Imidazole-2,4-Dicarboxylic Acid |