|
CAS#: 17605-87-7 Product: 1-[(3,5-Dimethyl-4-Isoxazolyl)Sulfonyl]-3,5-Dimethyl-1H-Pyrazole No suppilers available for the product. |
| Name | 1-[(3,5-Dimethyl-4-Isoxazolyl)Sulfonyl]-3,5-Dimethyl-1H-Pyrazole |
|---|---|
| Synonyms | 4-(3,5-Dimethylpyrazol-1-Yl)Sulfonyl-3,5-Dimethyl-Isoxazole; 4-[(3,5-Dimethyl-1-Pyrazolyl)Sulfonyl]-3,5-Dimethylisoxazole; 3,5-Dimethyl-1-(3,5-Dimethyl-4-Isoxazolylsulfonyl)Pyrazole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.29 |
| CAS Registry Number | 17605-87-7 |
| SMILES | C1=C([N](N=C1C)[S](=O)(=O)C2=C(ON=C2C)C)C |
| InChI | 1S/C10H13N3O3S/c1-6-5-7(2)13(11-6)17(14,15)10-8(3)12-16-9(10)4/h5H,1-4H3 |
| InChIKey | QCQOTHAMYAUOGF-UHFFFAOYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.724°C at 760 mmHg (Cal.) |
| Flash point | 231.228°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(3,5-Dimethyl-4-Isoxazolyl)Sulfonyl]-3,5-Dimethyl-1H-Pyrazole |