|
CAS#: 1763-14-0 Product: Flavaspidinin No suppilers available for the product. |
| Name | Flavaspidinin |
|---|---|
| Synonyms | 1-[3-[(3-Butanoyl-2,4-Dihydroxy-6-Methoxy-Phenyl)Methyl]-2,4,6-Trihydroxy-5-Methyl-Phenyl]Butan-1-One; 1-[3-[[2,4-Dihydroxy-6-Methoxy-3-(1-Oxobutyl)Phenyl]Methyl]-2,4,6-Trihydroxy-5-Methylphenyl]Butan-1-One; 1-[3-(3-Butyryl-2,4-Dihydroxy-6-Methoxy-Benzyl)-2,4,6-Trihydroxy-5-Methyl-Phenyl]Butan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 |
| CAS Registry Number | 1763-14-0 |
| SMILES | C1=C(C(=C(C(=C1O)C(=O)CCC)O)CC2=C(C(=C(O)C(=C2O)C(=O)CCC)C)O)OC |
| InChI | 1S/C23H28O8/c1-5-7-14(24)18-16(26)10-17(31-4)12(22(18)29)9-13-20(27)11(3)21(28)19(23(13)30)15(25)8-6-2/h10,26-30H,5-9H2,1-4H3 |
| InChIKey | ZMGUIBLJRFUNEX-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 678.622°C at 760 mmHg (Cal.) |
| Flash point | 232.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Flavaspidinin |