|
CAS#: 176434-89-2 Product: [4-(2-Amino-6-Oxo-3H-Purin-9-Yl)-2-Methylidenebutoxy]Methylphosphonic Acid No suppilers available for the product. |
| Name | [4-(2-Amino-6-Oxo-3H-Purin-9-Yl)-2-Methylidenebutoxy]Methylphosphonic Acid |
|---|---|
| Synonyms | [4-(2-Amino-6-Oxo-3H-Purin-9-Yl)-2-Methylene-Butoxy]Methylphosphonic Acid; [4-(2-Amino-6-Oxo-3H-Purin-9-Yl)-2-Methylenebutoxy]Methylphosphonic Acid; 2-[2-(2-Amino-6-Keto-3H-Purin-9-Yl)Ethyl]Prop-2-Enoxymethylphosphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N5O5P |
| Molecular Weight | 329.25 |
| CAS Registry Number | 176434-89-2 |
| SMILES | C1=NC2=C([N]1CCC(COC[P](=O)(O)O)=C)NC(=NC2=O)N |
| InChI | 1S/C11H16N5O5P/c1-7(4-21-6-22(18,19)20)2-3-16-5-13-8-9(16)14-11(12)15-10(8)17/h5H,1-4,6H2,(H2,18,19,20)(H3,12,14,15,17) |
| InChIKey | KCQPHHMIPYIKOA-UHFFFAOYSA-N |
| Density | 1.736g/cm3 (Cal.) |
|---|---|
| Boiling point | 720.908°C at 760 mmHg (Cal.) |
| Flash point | 389.791°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(2-Amino-6-Oxo-3H-Purin-9-Yl)-2-Methylidenebutoxy]Methylphosphonic Acid |