|
CAS#: 17667-37-7 Product: Valeric Acid 2-(4-Nitrophenyl)Hydrazide No suppilers available for the product. |
| Name | Valeric Acid 2-(4-Nitrophenyl)Hydrazide |
|---|---|
| Synonyms | N'-(4-Nitrophenyl)Valerohydrazide; Brn 0659984; Pentanoic Acid, 2-(P-Nitrophenyl)Hydrazide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 |
| CAS Registry Number | 17667-37-7 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)NNC(=O)CCCC |
| InChI | 1S/C11H15N3O3/c1-2-3-4-11(15)13-12-9-5-7-10(8-6-9)14(16)17/h5-8,12H,2-4H2,1H3,(H,13,15) |
| InChIKey | YNBAEPKMVZRBQQ-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.314°C at 760 mmHg (Cal.) |
| Flash point | 165.059°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Valeric Acid 2-(4-Nitrophenyl)Hydrazide |