|
CAS#: 17677-87-1 Product: 2,2,6-Trimethyl-1-Oxaspiro[2.5]Octan-8-One No suppilers available for the product. |
| Name | 2,2,6-Trimethyl-1-Oxaspiro[2.5]Octan-8-One |
|---|---|
| Synonyms | P-Menthan-3-One, 4,8-Epoxy-, Cis-; 2,2,6-Trimethyl-1-Oxaspiro(2.5)Octan-4-One; Nsc 316069 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 |
| CAS Registry Number | 17677-87-1 |
| SMILES | CC2(C)C1(C(CC(C)CC1)=O)O2 |
| InChI | 1S/C10H16O2/c1-7-4-5-10(8(11)6-7)9(2,3)12-10/h7H,4-6H2,1-3H3 |
| InChIKey | OFUGTKAUAMKFPM-UHFFFAOYSA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.093°C at 760 mmHg (Cal.) |
| Flash point | 97.993°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,6-Trimethyl-1-Oxaspiro[2.5]Octan-8-One |