|
CAS#: 17697-46-0 Product: 1-(2-Methyl-2-Nitropropyl)Piperidine No suppilers available for the product. |
| Name | 1-(2-Methyl-2-Nitropropyl)Piperidine |
|---|---|
| Synonyms | 1-(2-Methyl-2-Nitro-Propyl)Piperidine; N-(2-Nitroisobutyl)Piperidine; Piperidine, N-(2-Methyl-2-Nitropropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 |
| CAS Registry Number | 17697-46-0 |
| SMILES | C(N1CCCCC1)C([N+]([O-])=O)(C)C |
| InChI | 1S/C9H18N2O2/c1-9(2,11(12)13)8-10-6-4-3-5-7-10/h3-8H2,1-2H3 |
| InChIKey | KWULWMUTIBFSHV-UHFFFAOYSA-N |
| Density | 1.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.66°C at 760 mmHg (Cal.) |
| Flash point | 117.491°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methyl-2-Nitropropyl)Piperidine |