|
CAS#: 176972-62-6 Product: Methyl [(2S,3S)-4-Chloro-3-Hydroxy-1-Phenyl-2-Butanyl]Carbamate No suppilers available for the product. |
| Name | Methyl [(2S,3S)-4-Chloro-3-Hydroxy-1-Phenyl-2-Butanyl]Carbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.71 |
| CAS Registry Number | 176972-62-6 |
| SMILES | COC(=O)NC(Cc1ccccc1)C(CCl)O |
| InChI | 1S/C12H16ClNO3/c1-17-12(16)14-10(11(15)8-13)7-9-5-3-2-4-6-9/h2-6,10-11,15H,7-8H2,1H3,(H,14,16)/t10-,11+/m0/s1 |
| InChIKey | ZAZXPIZQYVPWAW-WDEREUQCSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.021°C at 760 mmHg (Cal.) |
| Flash point | 221.731°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl [(2S,3S)-4-Chloro-3-Hydroxy-1-Phenyl-2-Butanyl]Carbamate |