|
CAS#: 177087-92-2 Product: Trimethyl[(3-Methyl-1-Cyclopenten-1-Yl)Methyl]Silane No suppilers available for the product. |
| Name | Trimethyl[(3-Methyl-1-Cyclopenten-1-Yl)Methyl]Silane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H20Si |
| Molecular Weight | 168.35 |
| CAS Registry Number | 177087-92-2 |
| SMILES | C1(=C/C(C)CC1)\C[Si](C)(C)C |
| InChI | 1S/C10H20Si/c1-9-5-6-10(7-9)8-11(2,3)4/h7,9H,5-6,8H2,1-4H3 |
| InChIKey | UIAABQPBPDPDKO-UHFFFAOYSA-N |
| Density | 0.816g/cm3 (Cal.) |
|---|---|
| Boiling point | 186.207°C at 760 mmHg (Cal.) |
| Flash point | 54.28°C (Cal.) |
| Refractive index | 1.443 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl[(3-Methyl-1-Cyclopenten-1-Yl)Methyl]Silane |