|
CAS#: 17709-43-2 Product: Phosphoric Acid Tris[3,5-Bis(1,1-Dimethylethyl)-4-Hydroxyphenyl] Ester No suppilers available for the product. |
| Name | Phosphoric Acid Tris[3,5-Bis(1,1-Dimethylethyl)-4-Hydroxyphenyl] Ester |
|---|---|
| Synonyms | Tris(3,5-Ditert-Butyl-4-Hydroxy-Phenyl) Phosphate; Phosphoric Acid Tris(3,5-Ditert-Butyl-4-Hydroxyphenyl) Ester; Phosphoric Acid Tris(3,5-Ditert-Butyl-4-Hydroxy-Phenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C42H63O7P |
| Molecular Weight | 710.93 |
| CAS Registry Number | 17709-43-2 |
| SMILES | C1=C(C(=C(C=C1O[P](=O)(OC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C)OC3=CC(=C(C(=C3)C(C)(C)C)O)C(C)(C)C)C(C)(C)C)O)C(C)(C)C |
| InChI | 1S/C42H63O7P/c1-37(2,3)28-19-25(20-29(34(28)43)38(4,5)6)47-50(46,48-26-21-30(39(7,8)9)35(44)31(22-26)40(10,11)12)49-27-23-32(41(13,14)15)36(45)33(24-27)42(16,17)18/h19-24,43-45H,1-18H3 |
| InChIKey | HOQYYGLJPAIXDU-UHFFFAOYSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 651.765°C at 760 mmHg (Cal.) |
| Flash point | 347.975°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphoric Acid Tris[3,5-Bis(1,1-Dimethylethyl)-4-Hydroxyphenyl] Ester |