|
CAS#: 17719-29-8 Product: 3-Cyclohexyl-3-Phenylazetidin-2-One No suppilers available for the product. |
| Name | 3-Cyclohexyl-3-Phenylazetidin-2-One |
|---|---|
| Synonyms | 3-Cyclohexyl-3-Phenyl-Azetidin-2-One; 3-Cyclohexyl-3-Phenyl-2-Azetidinone; Brn 0211659 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 |
| CAS Registry Number | 17719-29-8 |
| SMILES | C3=C(C1(C(=O)NC1)C2CCCCC2)C=CC=C3 |
| InChI | 1S/C15H19NO/c17-14-15(11-16-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,16,17) |
| InChIKey | VFQZGLHTORSEPN-UHFFFAOYSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.263°C at 760 mmHg (Cal.) |
| Flash point | 251.778°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Cyclohexyl-3-Phenylazetidin-2-One |