|
CAS#: 1773-89-3 Product: Dimethyl 1,4,5,6,7,7-Hexachlorobicyclo[2.2.1]Hept-5-Ene-2,3-Dicarboxylate No suppilers available for the product. |
| Name | Dimethyl 1,4,5,6,7,7-Hexachlorobicyclo[2.2.1]Hept-5-Ene-2,3-Dicarboxylate |
|---|---|
| Synonyms | 1,2,3,4,7,7-Hexachlorobicyclo[2.2.1]Hept-2-Ene-5,6-Dicarboxylic Acid Dimethyl Ester; 5-Norbornene-2,3-Dicarboxylic Acid, 1,4,5,6,7,7-Hexachloro-, Dimethyl Ester; Bicyclo[2.2.1]Hept-5-Ene-2,3-Dicarboxylic Acid, 1,4,5,6,7,7-Hexachloro-, Dimethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8Cl6O4 |
| Molecular Weight | 416.90 |
| CAS Registry Number | 1773-89-3 |
| EINECS | 217-202-1 |
| SMILES | COC(C2C1(C(=C(Cl)C(Cl)(C1(Cl)Cl)C2C(=O)OC)Cl)Cl)=O |
| InChI | 1S/C11H8Cl6O4/c1-20-7(18)3-4(8(19)21-2)10(15)6(13)5(12)9(3,14)11(10,16)17/h3-4H,1-2H3 |
| InChIKey | MDHHRPHYYRMIPH-UHFFFAOYSA-N |
| Density | 1.711g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.431°C at 760 mmHg (Cal.) |
| Flash point | 162.783°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 1,4,5,6,7,7-Hexachlorobicyclo[2.2.1]Hept-5-Ene-2,3-Dicarboxylate |