|
CAS#: 17747-24-9 Product: 3-(Dimethoxyphosphinyloxy)-2-Butenoic Acid alpha-Ethylbenzyl Ester No suppilers available for the product. |
| Name | 3-(Dimethoxyphosphinyloxy)-2-Butenoic Acid alpha-Ethylbenzyl Ester |
|---|---|
| Synonyms | (Z)-3-Dimethoxyphosphoryloxybut-2-Enoic Acid 1-Phenylpropyl Ester; Ent 25,839; Sd 8306 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21O6P |
| Molecular Weight | 328.30 |
| CAS Registry Number | 17747-24-9 |
| SMILES | C1=C(C(OC(=O)/C=C(O[P](OC)(OC)=O)/C)CC)C=CC=C1 |
| InChI | 1S/C15H21O6P/c1-5-14(13-9-7-6-8-10-13)20-15(16)11-12(2)21-22(17,18-3)19-4/h6-11,14H,5H2,1-4H3/b12-11- |
| InChIKey | VXGOMXKHOGFASB-QXMHVHEDSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.385°C at 760 mmHg (Cal.) |
| Flash point | 197.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Dimethoxyphosphinyloxy)-2-Butenoic Acid alpha-Ethylbenzyl Ester |