|
CAS#: 17755-37-2 Product: 2-[(4-Hydroxyphenyl)Thio]Phenol No suppilers available for the product. |
| Name | 2-[(4-Hydroxyphenyl)Thio]Phenol |
|---|---|
| Synonyms | 2-[(4-Hydroxyphenyl)Thio]Phenol; Phenol, 2-((4-Hydroxyphenyl)Thio)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.27 |
| CAS Registry Number | 17755-37-2 |
| SMILES | C1=C(C=CC(=C1)O)SC2=C(O)C=CC=C2 |
| InChI | 1S/C12H10O2S/c13-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)14/h1-8,13-14H |
| InChIKey | HHGJAYGHIYSKEE-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.063°C at 760 mmHg (Cal.) |
| Flash point | 192.899°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Hydroxyphenyl)Thio]Phenol |