|
CAS#: 17761-74-9 Product: 2-Methyl-3-Phenyl-2,3-Dihydro-4(1H)-Quinazolinone No suppilers available for the product. |
| Name | 2-Methyl-3-Phenyl-2,3-Dihydro-4(1H)-Quinazolinone |
|---|---|
| Synonyms | 2-Methyl-3-phenyl-2,3-dihydro-4(1H)-quinazolinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.28 |
| CAS Registry Number | 17761-74-9 |
| SMILES | O=C2c1c(cccc1)NC(N2c3ccccc3)C |
| InChI | 1S/C15H14N2O/c1-11-16-14-10-6-5-9-13(14)15(18)17(11)12-7-3-2-4-8-12/h2-11,16H,1H3 |
| InChIKey | GRHYFGQUSLNRSA-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.645°C at 760 mmHg (Cal.) |
| Flash point | 209.408°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-Phenyl-2,3-Dihydro-4(1H)-Quinazolinone |