|
CAS#: 17788-00-0 Product: 2,4-Dichloro-m-Cresol No suppilers available for the product. |
| Name | 2,4-Dichloro-m-Cresol |
|---|---|
| Synonyms | 2,4-Dichloro-3-Methyl-Phenol; Inchi=1/C7h6cl2o/C1-4-5(8)2-3-6(10)7(4)9/H2-3,10H,1H; 2,4-Dichloro-M-Cresol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 177.03 |
| CAS Registry Number | 17788-00-0 |
| EINECS | 241-765-2 |
| SMILES | C1=C(C(=C(C(=C1)O)Cl)C)Cl |
| InChI | 1S/C7H6Cl2O/c1-4-5(8)2-3-6(10)7(4)9/h2-3,10H,1H3 |
| InChIKey | GIXSFSVVKULPEK-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.87°C at 760 mmHg (Cal.) |
| Flash point | 108.249°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-m-Cresol |