|
CAS#: 1781-49-3 Product: 2,3-Diisopropylidene-1,1-Dimethylcyclopropane No suppilers available for the product. |
| Name | 2,3-Diisopropylidene-1,1-Dimethylcyclopropane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 |
| CAS Registry Number | 1781-49-3 |
| SMILES | C(=C1\C(=C(/C)C)C1(C)C)(\C)C |
| InChI | 1S/C11H18/c1-7(2)9-10(8(3)4)11(9,5)6/h1-6H3 |
| InChIKey | OUVVCPGFEIBUCG-UHFFFAOYSA-N |
| Density | 0.857g/cm3 (Cal.) |
|---|---|
| Boiling point | 175.326°C at 760 mmHg (Cal.) |
| Flash point | 48.797°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Diisopropylidene-1,1-Dimethylcyclopropane |