|
CAS#: 1782-06-5 Product: 5,6,7,8,10,10-Hexachloro-3a,4,4a,5,8,8a,9,9a-Octahydro-5,8-Methanonaphtho[2,3-c]Furan-1,3-Dione No suppilers available for the product. |
| Name | 5,6,7,8,10,10-Hexachloro-3a,4,4a,5,8,8a,9,9a-Octahydro-5,8-Methanonaphtho[2,3-c]Furan-1,3-Dione |
|---|---|
| Synonyms | 1,4-Methanonaphthalene-6,7-Dicarboxylic Anhydride, 1,2,3,4,9,9-Hexachloro-1,4,4A,5,6,7,8,8A-Octahydro-; 1,2,3,4,9,9-Hexachloro-1,4,4A,5,6,7,8,8A-Octahydro-1,4-Methanonaphthalene-6,7-Dicarboxylic Anhydride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8Cl6O3 |
| Molecular Weight | 424.92 |
| CAS Registry Number | 1782-06-5 |
| EINECS | 217-229-9 |
| SMILES | O=C3C2CC1C4(C(C(Cl)(C1CC2C(=O)O3)C(=C4Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/C13H8Cl6O3/c14-7-8(15)12(17)6-2-4-3(9(20)22-10(4)21)1-5(6)11(7,16)13(12,18)19/h3-6H,1-2H2 |
| InChIKey | WGLYADVYCJUFAY-UHFFFAOYSA-N |
| Density | 1.818g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.661°C at 760 mmHg (Cal.) |
| Flash point | 204.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7,8,10,10-Hexachloro-3a,4,4a,5,8,8a,9,9a-Octahydro-5,8-Methanonaphtho[2,3-c]Furan-1,3-Dione |