|
CAS#: 1785-09-7 Product: 2,7-Dibromo-9H-Fluoren-4-Amine No suppilers available for the product. |
| Name | 2,7-Dibromo-9H-Fluoren-4-Amine |
|---|---|
| Synonyms | (2,7-Dibromo-9H-Fluoren-4-Yl)Amine; Nsc91426; Nciopen2_009742 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9Br2N |
| Molecular Weight | 339.03 |
| CAS Registry Number | 1785-09-7 |
| SMILES | C1=CC(=CC2=C1C3=C(C2)C=C(C=C3N)Br)Br |
| InChI | 1S/C13H9Br2N/c14-9-1-2-11-7(4-9)3-8-5-10(15)6-12(16)13(8)11/h1-2,4-6H,3,16H2 |
| InChIKey | ZCRGFCZFXXGGDT-UHFFFAOYSA-N |
| Density | 1.853g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.898°C at 760 mmHg (Cal.) |
| Flash point | 242.824°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Dibromo-9H-Fluoren-4-Amine |