|
CAS#: 17860-87-6 Product: 2-O-Methyl-L-Ascorbic acid No suppilers available for the product. |
| Name | 2-O-Methyl-L-Ascorbic acid |
|---|---|
| Synonyms | 2-Methylascorbic acid; 2-O-Methylascorbic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 |
| CAS Registry Number | 17860-87-6 |
| SMILES | O=C1C(\OC)=C(\O)OC1C(O)CO |
| InChI | 1S/C7H10O6/c1-12-6-4(10)5(3(9)2-8)13-7(6)11/h3,5,8-9,11H,2H2,1H3 |
| InChIKey | RMHBODZVODTFAH-UHFFFAOYSA-N |
| Density | 1.55g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.076°C at 760 mmHg (Cal.) |
| Flash point | 183.223°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-O-Methyl-L-Ascorbic acid |