|
CAS#: 17881-28-6 Product: Phenyl(Trimethylsilyl)-Diazene No suppilers available for the product. |
| Name | Phenyl(Trimethylsilyl)-Diazene |
|---|---|
| Synonyms | Phenyl-Trimethylsilyl-Diazene; Diazene,Phenyl(Trimethylsilyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N2Si |
| Molecular Weight | 178.31 |
| CAS Registry Number | 17881-28-6 |
| SMILES | C1=C(N=N[Si](C)(C)C)C=CC=C1 |
| InChI | 1S/C9H14N2Si/c1-12(2,3)11-10-9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | YIJCWHMUQPKHEP-UHFFFAOYSA-N |
| Density | 0.915g/cm3 (Cal.) |
|---|---|
| Boiling point | 206.163°C at 760 mmHg (Cal.) |
| Flash point | 78.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(Trimethylsilyl)-Diazene |