|
CAS#: 17893-55-9 Product: [(4-Nitrophenyl)Seleno]Acetic Acid No suppilers available for the product. |
| Name | [(4-Nitrophenyl)Seleno]Acetic Acid |
|---|---|
| Synonyms | 2-[(4-Nitrophenyl)Seleno]Acetic Acid; 2-(4-Nitrophenyl)Selanylethanoic Acid; Brn 2270000 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7NO4Se |
| Molecular Weight | 260.11 |
| CAS Registry Number | 17893-55-9 |
| SMILES | C1=CC(=CC=C1[Se]CC(O)=O)[N+]([O-])=O |
| InChI | 1S/C8H7NO4Se/c10-8(11)5-14-7-3-1-6(2-4-7)9(12)13/h1-4H,5H2,(H,10,11) |
| InChIKey | YQPXZFWIJXKUPR-UHFFFAOYSA-N |
| Boiling point | 429.377°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 213.48°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(4-Nitrophenyl)Seleno]Acetic Acid |