|
CAS#: 17909-92-1 Product: Ketopelenolid-A No suppilers available for the product. |
| Name | Ketopelenolid-A |
|---|---|
| Synonyms | (3R,3As,6Z,10S,11Ar)-3,6,10-Trimethyl-3,3A,4,5,8,10,11,11A-Octahydrocyclodeca[D]Furan-2,9-Quinone; Cyclodeca(B)Furan-2,9(3H,4H)-Dione, 3A,5,8,10,11,11A-Hexahydro-3,6,10-Trimethyl-, (3R-(3R*,3As*,6E,10S*,11Ar*))-; Ketopelenolid-A |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 |
| CAS Registry Number | 17909-92-1 |
| SMILES | [C@@H]12[C@H](OC(=O)[C@@H]1C)C[C@@H](C(=O)C/C=C(CC2)/C)C |
| InChI | 1S/C15H22O3/c1-9-4-6-12-11(3)15(17)18-14(12)8-10(2)13(16)7-5-9/h5,10-12,14H,4,6-8H2,1-3H3/b9-5-/t10-,11+,12-,14+/m0/s1 |
| InChIKey | KLZWSNKEPLKAOS-KBQMSFDJSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.792°C at 760 mmHg (Cal.) |
| Flash point | 179.683°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ketopelenolid-A |