|
CAS#: 17929-68-9 Product: Indole-3-Acetyl-epsilon-Lysine No suppilers available for the product. |
| Name | Indole-3-Acetyl-epsilon-Lysine |
|---|---|
| Synonyms | (2S)-2-Amino-6-[[2-(1H-Indol-3-Yl)-1-Oxoethyl]Amino]Hexanoic Acid; (2S)-2-Amino-6-[2-(1H-Indol-3-Yl)Ethanoylamino]Hexanoic Acid; C04211 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 |
| CAS Registry Number | 17929-68-9 |
| SMILES | [C@H](C(=O)O)(N)CCCCNC(=O)CC1=C[NH]C2=C1C=CC=C2 |
| InChI | 1S/C16H21N3O3/c17-13(16(21)22)6-3-4-8-18-15(20)9-11-10-19-14-7-2-1-5-12(11)14/h1-2,5,7,10,13,19H,3-4,6,8-9,17H2,(H,18,20)(H,21,22)/t13-/m0/s1 |
| InChIKey | FKIGOUKDKBOZID-ZDUSSCGKSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 650.502°C at 760 mmHg (Cal.) |
| Flash point | 347.211°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indole-3-Acetyl-epsilon-Lysine |