|
CAS#: 17944-62-6 Product: 2-(2-Chloroethyl)-6-methylpyridine hydrochloride No suppilers available for the product. |
| Name | 2-(2-Chloroethyl)-6-methylpyridine hydrochloride |
|---|---|
| Synonyms | 2-(2-Chloroethyl)-6-Methylpyridine Hydrochloride; 2-Picoline, 6-(2-Chloroethyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11Cl2N |
| Molecular Weight | 192.09 |
| CAS Registry Number | 17944-62-6 |
| SMILES | [H+].C1=CC=C(N=C1CCCl)C.[Cl-] |
| InChI | 1S/C8H10ClN.ClH/c1-7-3-2-4-8(10-7)5-6-9;/h2-4H,5-6H2,1H3;1H |
| InChIKey | YWRMCDUVMFQGGN-UHFFFAOYSA-N |
| Boiling point | 218.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 106.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Chloroethyl)-6-methylpyridine hydrochloride |