Online Database of Chemicals from Around the World
| Name | 2-[(Dimethoxyphosphinyl)Thio]Butanedioic Acid Dimethyl Ester |
|---|---|
| Synonyms | 2-(Dimethoxyphosphorylthio)Butanedioic Acid Dimethyl Ester; 2-(Dimethoxyphosphorylthio)Succinic Acid Dimethyl Ester; Brn 1802413 |
| Molecular Structure | ![CAS#: 1795-58-0, 2-[(Dimethoxyphosphinyl)Thio]Butanedioic Acid Dimethyl Ester](/moreStructures/1795-58-0.gif) |
| Molecular Formula | C8H15O7PS |
| Molecular Weight | 286.24 |
| CAS Registry Number | 1795-58-0 |
| SMILES | C(C(S[P](=O)(OC)OC)C(=O)OC)C(=O)OC |
| InChI | 1S/C8H15O7PS/c1-12-7(9)5-6(8(10)13-2)17-16(11,14-3)15-4/h6H,5H2,1-4H3 |
| InChIKey | ZHVVLAPWOXUPHN-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.981°C at 760 mmHg (Cal.) |
| Flash point | 163.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(Dimethoxyphosphinyl)Thio]Butanedioic Acid Dimethyl Ester |
