|
CAS#: 17955-47-4 Product: 1,1-Propanediylbis(Triethylsilane) No suppilers available for the product. |
| Name | 1,1-Propanediylbis(Triethylsilane) |
|---|---|
| Synonyms | Silane, propylidenebis*triethyl-; Triethyl[1-(triethylsilyl)propyl]silane # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H36Si2 |
| Molecular Weight | 272.62 |
| CAS Registry Number | 17955-47-4 |
| SMILES | CC[Si](CC)(C([Si](CC)(CC)CC)CC)CC |
| InChI | 1S/C15H36Si2/c1-8-15(16(9-2,10-3)11-4)17(12-5,13-6)14-7/h15H,8-14H2,1-7H3 |
| InChIKey | VWFCXQRCCLPCOU-UHFFFAOYSA-N |
| Density | 0.783g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.384°C at 760 mmHg (Cal.) |
| Flash point | 105.993°C (Cal.) |
| Refractive index | 1.425 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Propanediylbis(Triethylsilane) |